CAS 138907-81-0 appears in our catalog under these names: 1-(4-Fluorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Fluoro-phenyl)-1H-pyrazole-4-carboxylic acid, 1-(4-Fluorophenyl)-1H-pyrazole-4-carboxylic acid 95%, 1-(4-Fluorophenyl)-1H-pyrazole-4-carboxylic acid, 95%, 95%, 1-(4-Fluoro-phenyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 2g, 100mg, 250mg, 500mg.
1-(4-fluorophenyl)pyrazole-4-carboxylic acid (CAS 138907-81-0) is a chemical compound with the molecular formula C10H7FN2O2 and a molecular weight of 206.17 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrazole-4-carboxylic acid. InChIKey: VHGLETHNIUVDGO-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrazole-4-carboxylic acid |
| InChIKey | VHGLETHNIUVDGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(C=N2)C(=O)O)F |
Computed by PubChem (NCBI)