CAS 851721-89-6 appears in our catalog under these names: 1-(4-Fluorophenyl)-1h-imidazole-5-carboxylic acid, 98%, 1-(4-Fluorophenyl)-1H-imidazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 50mg, 0,5g.
3-(4-fluorophenyl)imidazole-4-carboxylic acid (CAS 851721-89-6) is a chemical compound with the molecular formula C10H7FN2O2 and a molecular weight of 206.17 g/mol. IUPAC name: 3-(4-fluorophenyl)imidazole-4-carboxylic acid. InChIKey: FNLCJIQJPGSGMV-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 3-(4-fluorophenyl)imidazole-4-carboxylic acid |
| InChIKey | FNLCJIQJPGSGMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NC=C2C(=O)O)F |
Computed by PubChem (NCBI)