cas: 27463-47-4 — see every product listed under this CAS number, including other names
5-(4-Isopropylphenyl)cyclohexane-1,3-dione, 98% (CAS 27463-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A255884-100mg |
| cas | 27463-47-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 5147.80 Pln | |
| AmBeed | 1g | 11403.91 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(4-propan-2-ylphenyl)cyclohexane-1,3-dione (CAS 27463-47-4) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: 5-(4-propan-2-ylphenyl)cyclohexane-1,3-dione. InChIKey: GZEOADDHUHXTCJ-UHFFFAOYSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 5-(4-propan-2-ylphenyl)cyclohexane-1,3-dione |
| InChIKey | GZEOADDHUHXTCJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)