cas: 23766-26-9 — see every product listed under this CAS number, including other names
5-(4-Methoxyphenyl)-1,3,4-oxadiazole-2-thiol, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 23766-26-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118NEW-250mg |
| cas | 23766-26-9 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 808.40 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
5-(4-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 23766-26-9) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 5-(4-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: UGHZJAXROLHKEH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | UGHZJAXROLHKEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)