cas: 68319-44-8 — see every product listed under this CAS number, including other names
5-(4-Nitrobenzyl)imidazolidine-2,4-dione, 98% (CAS 68319-44-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1432269-250mg |
| cas | 68319-44-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 493.15 Pln | |
| AmBeed | 10g | 6163.36 Pln | |
| AmBeed | 5g | 3539.83 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione (CAS 68319-44-8) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: 5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione. InChIKey: COZUHTATRBKBAO-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 5-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione |
| InChIKey | COZUHTATRBKBAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2C(=O)NC(=O)N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)