CAS 83996-81-0 is the registry number for 1-Methyl-3-(3-nitrophenyl)imidazolidine-2,4-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-methyl-3-(3-nitrophenyl)imidazolidine-2,4-dione (CAS 83996-81-0) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: 1-methyl-3-(3-nitrophenyl)imidazolidine-2,4-dione. InChIKey: LVLMPGIBDDHXIK-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 1-methyl-3-(3-nitrophenyl)imidazolidine-2,4-dione |
| InChIKey | LVLMPGIBDDHXIK-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N(C1=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)