Products 872728-82-0

CAS 872728-82-0 is the registry number for 2-(4-(5-Oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)phenylamino)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)anilino]acetic acid (CAS 872728-82-0) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: 2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)anilino]acetic acid. InChIKey: USTVSOSEROPCIX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9N3O4
Molecular weight235.20 g/mol
IUPAC name2-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)anilino]acetic acid
InChIKeyUSTVSOSEROPCIX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NOC(=O)N2)NCC(=O)O

Computed by PubChem (NCBI)