CAS 1351393-88-8 appears in our catalog under these names: 4-(5,7-Dioxo-5,7-dihydro-6h-pyrrolo[3,4-b]pyrazin-6-yl)butanoic acid, 95%, 4-(5,7-DIoxo-5,7-dihydro-6h-pyrrolo(3,4-b)pyrazin-6-yl)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)butanoic acid (CAS 1351393-88-8) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: 4-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)butanoic acid. InChIKey: JJKOHOGQERDKSO-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 4-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)butanoic acid |
| InChIKey | JJKOHOGQERDKSO-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=O)N(C2=O)CCCC(=O)O |
Computed by PubChem (NCBI)