CAS 5236-72-6 is the registry number for Ethyl cyano(3-nitropyridin-2-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g, 5g.
Ethyl 2-cyano-2-(3-nitro-2-pyridinyl)acetate (CAS 5236-72-6) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: ethyl 2-cyano-2-(3-nitro-2-pyridinyl)acetate. InChIKey: MKAXEULUCDDLLB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | ethyl 2-cyano-2-(3-nitro-2-pyridinyl)acetate |
| InChIKey | MKAXEULUCDDLLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)C1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)