cas: 869782-94-5 — see every product listed under this CAS number, including other names
5-(Trifluoromethoxy)-1h-indazole-3-carboxylic acid, 95% (CAS 869782-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | SS-2154-250mg |
| cas | 869782-94-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1195.43 Pln | |
| Fluorochem | 5g | 4251.65 Pln | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1195.43 Pln | |
| Fluorochem | 5g | 4251.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-(trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS 869782-94-5) is a chemical compound with the molecular formula C9H5F3N2O3 and a molecular weight of 246.14 g/mol. IUPAC name: 5-(trifluoromethoxy)-1H-indazole-3-carboxylic acid. InChIKey: DJKYXGHMEGLNLG-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O3 |
|---|---|
| Molecular weight | 246.14 g/mol |
| IUPAC name | 5-(trifluoromethoxy)-1H-indazole-3-carboxylic acid |
| InChIKey | DJKYXGHMEGLNLG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)