cas: 617678-32-7 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)-1H-imidazo[4,5-b]pyridine 97% (CAS 617678-32-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A267729-100mg |
| cas | 617678-32-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 1104.63 Pln | |
| Ambeed | 1g | 3201.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A267729 |
5-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine (CAS 617678-32-7) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine. InChIKey: JLWCYGRWTPNODY-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine |
| InChIKey | JLWCYGRWTPNODY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC=N2)C(F)(F)F |
Computed by PubChem (NCBI)