Products 1211517-40-6
CAS 1211517-40-6 appears in our catalog under these names: 3-(Trifluoromethyl)-1h-pyrazolo[4,3-b]pyridine, 95%, 3-(trifluoromethyl)-1H-pyrazolo(4,3-b)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine (CAS 1211517-40-6) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine. InChIKey: PVXRDHSMXOBFEC-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine |
| InChIKey | PVXRDHSMXOBFEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2N=C1)C(F)(F)F |
Computed by PubChem (NCBI)