CAS 73221-25-7 appears in our catalog under these names: 2-(Trifluoromethyl)imidazo[1,2-a]pyrimidine, 97%, 2-(Trifluoromethyl)imidazo(1,2-a)pyrimidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2-(trifluoromethyl)imidazo[1,2-a]pyrimidine (CAS 73221-25-7) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 2-(trifluoromethyl)imidazo[1,2-a]pyrimidine. InChIKey: YRFWGJGDOXKNHY-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 2-(trifluoromethyl)imidazo[1,2-a]pyrimidine |
| InChIKey | YRFWGJGDOXKNHY-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2N=C1)C(F)(F)F |
Computed by PubChem (NCBI)