CAS 1092459-55-6 is the registry number for 3-(Trifluoromethyl)-1h-pyrazolo[3,4-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
3-(trifluoromethyl)-2H-pyrazolo[3,4-c]pyridine (CAS 1092459-55-6) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-pyrazolo[3,4-c]pyridine. InChIKey: NWNYLUYEEDNUAY-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-pyrazolo[3,4-c]pyridine |
| InChIKey | NWNYLUYEEDNUAY-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=NNC(=C21)C(F)(F)F |
Computed by PubChem (NCBI)