cas: 617678-32-7 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)-1H-imidazo[4,5-b]pyridine, 97%, 97% (CAS 617678-32-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKY0-100mg |
| cas | 617678-32-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 947.60 Pln | |
| Chemat | 1g | 2560.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine (CAS 617678-32-7) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine. InChIKey: JLWCYGRWTPNODY-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-imidazo[4,5-b]pyridine |
| InChIKey | JLWCYGRWTPNODY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC=N2)C(F)(F)F |
Computed by PubChem (NCBI)