cas: 1129634-43-0 — see every product listed under this CAS number, including other names
5-(tert-Butyl) 6-methyl (S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 98% (CAS 1129634-43-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A860960-250mg |
| cas | 1129634-43-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 1744.31 Pln | |
| Ambeed | 10g | 2745.56 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 669.79 Pln | |
| BLDpharm | 5g | 1874.92 Pln | |
| BLDpharm | 10g | 2957.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-O-tert-butyl 6-O-methyl (6S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate (CAS 1129634-43-0) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 5-O-tert-butyl 6-O-methyl (6S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate. InChIKey: PCTAHDKKGGKHQK-VIFPVBQESA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 5-O-tert-butyl 6-O-methyl (6S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate |
| InChIKey | PCTAHDKKGGKHQK-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)