Products 2704674-72-4
CAS 2704674-72-4 appears in our catalog under these names: 5-TERT-BUTYL 6-METHYL (6R)-5-AZASPIRO[2.4]HEPTANE-5,6-DICARBOXYLATE, 97%, 97%, 5-TERT-BUTYL 6-METHYL (6R)-5-AZASPIRO[2.4]HEPTANE-5,6-DICARBOXYLATE, 97%. Offered by: Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
5-O-tert-butyl 6-O-methyl (6R)-5-azaspiro[2.4]heptane-5,6-dicarboxylate (CAS 2704674-72-4) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 5-O-tert-butyl 6-O-methyl (6R)-5-azaspiro[2.4]heptane-5,6-dicarboxylate. InChIKey: PCTAHDKKGGKHQK-SECBINFHSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 5-O-tert-butyl 6-O-methyl (6R)-5-azaspiro[2.4]heptane-5,6-dicarboxylate |
| InChIKey | PCTAHDKKGGKHQK-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)