CAS 1129634-43-0 appears in our catalog under these names: (S)-5-Boc-5-azaspiro[2.4]heptane-6-carboxylic acid methyl ester, 95%, (S)–5–tert–Butyl 6–methyl 5–azaspiro(2·4)heptane–5,6–dicarboxylate, 5-(tert-Butyl) 6-methyl (S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 97%, 97%, Ledipasvir impurity 53, 98.96%, Ledipasvir impurity 53 (Standard). Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g, 100 mg, 250 mg, 1 g, 500 mg.
5-O-tert-butyl 6-O-methyl (6S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate (CAS 1129634-43-0) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 5-O-tert-butyl 6-O-methyl (6S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate. InChIKey: PCTAHDKKGGKHQK-VIFPVBQESA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 5-O-tert-butyl 6-O-methyl (6S)-5-azaspiro[2.4]heptane-5,6-dicarboxylate |
| InChIKey | PCTAHDKKGGKHQK-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)