cas: 85943-26-6 — see every product listed under this CAS number, including other names
5-(tert-Butyl)-2-methoxybenzaldehyde 98% (CAS 85943-26-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112814-250mg |
| cas | 85943-26-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 693.00 Pln | |
| Ambeed | 500g | 2723.31 Pln | |
| Ambeed | 1000g | 5371.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112814 |
5-tert-butyl-2-methoxybenzaldehyde (CAS 85943-26-6) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 5-tert-butyl-2-methoxybenzaldehyde. InChIKey: OBYAZZBWVOYPRX-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 5-tert-butyl-2-methoxybenzaldehyde |
| InChIKey | OBYAZZBWVOYPRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)C=O |
Computed by PubChem (NCBI)