cas: 85943-26-6 — see every product listed under this CAS number, including other names
Benzaldehyde, 5-(1,1-dimethylethyl)-2-methoxy-, 95%, 95% (CAS 85943-26-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115MSE-100mg |
| cas | 85943-26-6 |
| size | 100mg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 100g | 568.40 Pln | |
| Chemat | 500g | 2284.80 Pln | |
| Chemat | 1kg | 4485.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-tert-butyl-2-methoxybenzaldehyde (CAS 85943-26-6) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 5-tert-butyl-2-methoxybenzaldehyde. InChIKey: OBYAZZBWVOYPRX-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 5-tert-butyl-2-methoxybenzaldehyde |
| InChIKey | OBYAZZBWVOYPRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)C=O |
Computed by PubChem (NCBI)