cas: 85943-26-6 — see every product listed under this CAS number, including other names
5-TERT-BUTYL-2-METHOXYBENZALDEHYDE, 97% (CAS 85943-26-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467232-1G |
| cas | 85943-26-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 138.51 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 721.64 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-tert-butyl-2-methoxybenzaldehyde (CAS 85943-26-6) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 5-tert-butyl-2-methoxybenzaldehyde. InChIKey: OBYAZZBWVOYPRX-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 5-tert-butyl-2-methoxybenzaldehyde |
| InChIKey | OBYAZZBWVOYPRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)C=O |
Computed by PubChem (NCBI)