cas: 2364585-40-8 — see every product listed under this CAS number, including other names
5-[3-(Propan-2-yl)phenyl]-1,3-oxazole, ≥95%, ≥95% (CAS 2364585-40-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132Q1S-1g |
| cas | 2364585-40-8 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2766.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-(3-propan-2-ylphenyl)-1,3-oxazole (CAS 2364585-40-8) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 5-(3-propan-2-ylphenyl)-1,3-oxazole. InChIKey: KWPWIZYIUPQYMX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 5-(3-propan-2-ylphenyl)-1,3-oxazole |
| InChIKey | KWPWIZYIUPQYMX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC(=C1)C2=CN=CO2 |
Computed by PubChem (NCBI)