cas: 1546211-12-4 — see every product listed under this CAS number, including other names
5-ACetyl-2-(4-nitrophenoxy) pyridine, 95% (CAS 1546211-12-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A722380-250mg |
| cas | 1546211-12-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2693.53 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[6-(4-nitrophenoxy)-3-pyridinyl]ethanone (CAS 1546211-12-4) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: 1-[6-(4-nitrophenoxy)-3-pyridinyl]ethanone. InChIKey: IZGKWONXCWCUSH-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1-[6-(4-nitrophenoxy)-3-pyridinyl]ethanone |
| InChIKey | IZGKWONXCWCUSH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)