CAS 1707737-27-6 is the registry number for 1-[(1H-Indol-4-ylcarbonyl)oxy]pyrrolidine-2,5-dione, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2,5-dioxopyrrolidin-1-yl) 1H-indole-4-carboxylate (CAS 1707737-27-6) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 1H-indole-4-carboxylate. InChIKey: YFCOSSNRPCJLCK-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 1H-indole-4-carboxylate |
| InChIKey | YFCOSSNRPCJLCK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=C3C=CNC3=CC=C2 |
Computed by PubChem (NCBI)