Products 50699-52-0
CAS 50699-52-0 appears in our catalog under these names: Phenyl 3-nitrophenylcarbamate, 95%, Phenyl (3-nitrophenyl)carbamate, 95+%, Phenyl N-(3-nitrophenyl)carbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Phenyl N-(3-nitrophenyl)carbamate (CAS 50699-52-0) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: phenyl N-(3-nitrophenyl)carbamate. InChIKey: JRBQTHUEPKJNBD-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | phenyl N-(3-nitrophenyl)carbamate |
| InChIKey | JRBQTHUEPKJNBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)