CAS 1546211-12-4 appears in our catalog under these names: 5-ACetyl-2-(4-nitrophenoxy) pyridine, 95%, 1-(6-(4-Nitrophenoxy)pyridin-3-yl)ethanone, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 250mg, 1g.
1-[6-(4-nitrophenoxy)-3-pyridinyl]ethanone (CAS 1546211-12-4) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: 1-[6-(4-nitrophenoxy)-3-pyridinyl]ethanone. InChIKey: IZGKWONXCWCUSH-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1-[6-(4-nitrophenoxy)-3-pyridinyl]ethanone |
| InChIKey | IZGKWONXCWCUSH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)