CAS 159190-73-5 is the registry number for 4-Nitro-3-(phenylamino)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
3-anilino-4-nitrobenzoic acid (CAS 159190-73-5) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: 3-anilino-4-nitrobenzoic acid. InChIKey: FVXNMUOKCJIVSY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 3-anilino-4-nitrobenzoic acid |
| InChIKey | FVXNMUOKCJIVSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC(=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)