5-Amino-2,3-dihydrophthalazine-1,4-dione, 98%
cas: 521-31-3 — see every product listed under this CAS number, including other names
5-Amino-2,3-dihydrophthalazine-1,4-dione, 98% (CAS 521-31-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0BJ-1g |
| cas | 521-31-3 |
| size | 1g |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 50g | 179.60 Pln | |
| Chemat | 100g | 290.00 Pln | |
| Chemat | 250g | 635.60 Pln | |
| Chemat | 500g | 1166.40 Pln | |
| Chemat | 1kg | 2114.00 Pln | |
| Chemat | 5kg | 8587.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-amino-2,3-dihydrophthalazine-1,4-dione (CAS 521-31-3) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-amino-2,3-dihydrophthalazine-1,4-dione. InChIKey: HWYHZTIRURJOHG-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-amino-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | HWYHZTIRURJOHG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)NNC2=O |
Computed by PubChem (NCBI)
Synonyms:
LUMINOL, 5-Amino-2,3-dihydro-1,4-phthalazinedione, 3-Aminophthalic hydrazide, 1,4-Phthalazinedione, 5-amino-2,3-dihydro-, o-aminophthalylhydrazide, 3-Aminophthalic acid hydrazide, o-Aminophthaloyl hydrazide, 3-Aminophthalhydrazide, 5-amino-2,3-dihydrophthalazine-1,4-dione, 5-Amino-1,2,3,4-tetrahydrophthalazine-1,4-dione