cas: 172404-33-0 — see every product listed under this CAS number, including other names
5-Amino-2-chloro-4-fluorobenzoic acid 98% (CAS 172404-33-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119035-250mg |
| cas | 172404-33-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1282.62 Pln | |
| Ambeed | 10g | 2139.25 Pln | |
| Ambeed | 25g | 4208.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A119035 |
5-amino-2-chloro-4-fluorobenzoic acid (CAS 172404-33-0) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 5-amino-2-chloro-4-fluorobenzoic acid. InChIKey: GANBUJGJERTPPV-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 5-amino-2-chloro-4-fluorobenzoic acid |
| InChIKey | GANBUJGJERTPPV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)F)Cl)C(=O)O |
Computed by PubChem (NCBI)