cas: 163271-32-7 — see every product listed under this CAS number, including other names
5-Aminolevulinic acid benzyl ester, HCl (CAS 163271-32-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TYP-5mg |
| cas | 163271-32-7 |
| size | 5mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 270.80 Pln | |
| Chemat | 10mg | 395.60 Pln | |
| Chemat | 25mg | 635.60 Pln | |
| Chemat | 50mg | 894.80 Pln | |
| Chemat | 1mg | 150.80 Pln | |
| Chemat | 100mg | 1326.80 Pln |
| delivery time | 3 weeks |
|---|
Benzyl 5-amino-4-oxopentanoate;hydrochloride (CAS 163271-32-7) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: benzyl 5-amino-4-oxopentanoate;hydrochloride. InChIKey: GHMCTRQKEALPCK-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | benzyl 5-amino-4-oxopentanoate;hydrochloride |
| InChIKey | GHMCTRQKEALPCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(=O)CN.Cl |
Computed by PubChem (NCBI)