Products 163271-32-7
CAS 163271-32-7 appears in our catalog under these names: 5-Aminolevulinic acid benzyl ester hydrochloride, 97%, 5-ALA benzyl ester hydrochloride, 97%, 5-ALA benzyl ester hydrochloride/ 97.11% (existing batch purity), 5–ALA benzyl ester hydrochloride, 5-Amino-4-oxopentanoic acid benzyl ester hydrochloride. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 5g, 1g, 5mg, 10mg, 25mg, 50mg, 100mg.
Benzyl 5-amino-4-oxopentanoate;hydrochloride (CAS 163271-32-7) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: benzyl 5-amino-4-oxopentanoate;hydrochloride. InChIKey: GHMCTRQKEALPCK-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | benzyl 5-amino-4-oxopentanoate;hydrochloride |
| InChIKey | GHMCTRQKEALPCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(=O)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
5-Aminolevulinic acid benzyl ester hydrochloride, Benzyl 5-amino-4-oxopentanoate hydrochloride, 5-Aminolevulinic acid benzyl ester, HCl, benzyl 5-amino-4-oxopentanoate;hydrochloride, 5-Amino-4-oxopentanoic acid benzyl ester hydrochloride, 5-ALA benzyl ester (hydrochloride), Benzyl-ALA (hydrochloride), delta-aminolevulinic acid benzyl ester hydrochloride, 5-aminolevulinic acid benzyl ester hcl, 5-ALA benzyl ester HCl