cas: 401811-78-7 — see every product listed under this CAS number, including other names
5-BROMO-1,3-BENZODIOXOL-4-AMINE, 96% (CAS 401811-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F534772-100MG |
| cas | 401811-78-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 1060.06 Pln | |
| Fluorochem | 1g | 1955.58 Pln | |
| Fluorochem | 5g | 7953.47 Pln | |
| Fluorochem | 10g | 10827.46 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-1,3-benzodioxol-4-amine (CAS 401811-78-7) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 5-bromo-1,3-benzodioxol-4-amine. InChIKey: LQAZIDHOTLRDSD-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxol-4-amine |
| InChIKey | LQAZIDHOTLRDSD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)N |
Computed by PubChem (NCBI)