cas: 401811-78-7 — see every product listed under this CAS number, including other names
5-Bromobenzo(d)(1,3)dioxol-4-amine, 98% (CAS 401811-78-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A290450-10g |
| cas | 401811-78-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 20804.35 Pln | |
| AmBeed | 5g | 12764.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-1,3-benzodioxol-4-amine (CAS 401811-78-7) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 5-bromo-1,3-benzodioxol-4-amine. InChIKey: LQAZIDHOTLRDSD-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxol-4-amine |
| InChIKey | LQAZIDHOTLRDSD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)N |
Computed by PubChem (NCBI)