cas: 618396-02-4 — see every product listed under this CAS number, including other names
5-Benzyl-3-phenylthiazolidine-2,4-dione, ≥95% (CAS 618396-02-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F775002-250MG |
| cas | 618396-02-4 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1710.87 Pln | |
| Fluorochem | 1g | 4116.28 Pln | |
| Fluorochem | 5g | 7776.45 Pln | |
| Fluorochem | 10g | 11348.11 Pln | |
| Chemat | 100mg | 702.80 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 4749.20 Pln | |
| Chemat | 10g | 6918.80 Pln |
| purity | ≥95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5-benzyl-3-phenyl-1,3-thiazolidine-2,4-dione (CAS 618396-02-4) is a chemical compound with the molecular formula C16H13NO2S and a molecular weight of 283.3 g/mol. IUPAC name: 5-benzyl-3-phenyl-1,3-thiazolidine-2,4-dione. InChIKey: YBASYDYUUWVFFT-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2S |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 5-benzyl-3-phenyl-1,3-thiazolidine-2,4-dione |
| InChIKey | YBASYDYUUWVFFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2C(=O)N(C(=O)S2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)