CAS 436096-59-2 appears in our catalog under these names: 7,8-Dimethyl-2-(2-thienyl)quinoline-4-carboxylic acid, 95%, 7,8-Dimethyl-2-(thiophen-2-yl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
7,8-dimethyl-2-thiophen-2-ylquinoline-4-carboxylic acid (CAS 436096-59-2) is a chemical compound with the molecular formula C16H13NO2S and a molecular weight of 283.3 g/mol. IUPAC name: 7,8-dimethyl-2-thiophen-2-ylquinoline-4-carboxylic acid. InChIKey: BRRXXRAMWJKFKQ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2S |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 7,8-dimethyl-2-thiophen-2-ylquinoline-4-carboxylic acid |
| InChIKey | BRRXXRAMWJKFKQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)C3=CC=CS3)C(=O)O)C |
Computed by PubChem (NCBI)