CAS 156274-05-4 is the registry number for Methyl 4-phenyl-3-(1h-pyrrol-1-yl)thiophene-2-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-phenyl-3-pyrrol-1-ylthiophene-2-carboxylate (CAS 156274-05-4) is a chemical compound with the molecular formula C16H13NO2S and a molecular weight of 283.3 g/mol. IUPAC name: methyl 4-phenyl-3-pyrrol-1-ylthiophene-2-carboxylate. InChIKey: MPEGFYGBQCLDNE-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2S |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | methyl 4-phenyl-3-pyrrol-1-ylthiophene-2-carboxylate |
| InChIKey | MPEGFYGBQCLDNE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CS1)C2=CC=CC=C2)N3C=CC=C3 |
Computed by PubChem (NCBI)