CAS 618396-02-4 appears in our catalog under these names: 5-Benzyl-3-phenylthiazolidine-2,4-dione, 98%, 5-Benzyl-3-phenylthiazolidine-2,4-dione, ≥95%, ≥95%, 5-Benzyl-3-phenylthiazolidine-2,4-dione, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
5-benzyl-3-phenyl-1,3-thiazolidine-2,4-dione (CAS 618396-02-4) is a chemical compound with the molecular formula C16H13NO2S and a molecular weight of 283.3 g/mol. IUPAC name: 5-benzyl-3-phenyl-1,3-thiazolidine-2,4-dione. InChIKey: YBASYDYUUWVFFT-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2S |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 5-benzyl-3-phenyl-1,3-thiazolidine-2,4-dione |
| InChIKey | YBASYDYUUWVFFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2C(=O)N(C(=O)S2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)