Products 436092-61-4
CAS 436092-61-4 appears in our catalog under these names: 6-Ethyl-2-thien-2-ylquinoline-4-carboxylic acid, 95%, 6-Ethyl-2-(thiophen-2-yl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-ethyl-2-thiophen-2-ylquinoline-4-carboxylic acid (CAS 436092-61-4) is a chemical compound with the molecular formula C16H13NO2S and a molecular weight of 283.3 g/mol. IUPAC name: 6-ethyl-2-thiophen-2-ylquinoline-4-carboxylic acid. InChIKey: KIQARWZTNCCNMN-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2S |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 6-ethyl-2-thiophen-2-ylquinoline-4-carboxylic acid |
| InChIKey | KIQARWZTNCCNMN-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=CC=CS3 |
Computed by PubChem (NCBI)