cas: 3530-82-3 — see every product listed under this CAS number, including other names
5-Benzylimidazolidine-2,4-dione, 98% (CAS 3530-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A503082-250mg |
| cas | 3530-82-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 636.37 Pln | |
| AmBeed | 100mg | 467.11 Pln | |
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 500mg | 758.08 Pln | |
| Fluorochem | 1g | 935.11 Pln | |
| Fluorochem | 5g | 4376.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-benzylhydantoin is an imidazolidine-2,4-dione that is hydantoin substituted by a benzyl group at position 5. It is a member of benzenes and an imidazolidine-2,4-dione.
Source: ChEBI
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 5-benzylimidazolidine-2,4-dione |
| InChIKey | DBOMTIHROGSFTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)