cas: 27219-07-4 — see every product listed under this CAS number, including other names
5-Boc-amino-pentanoic acid, 95% (CAS 27219-07-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037092-1G |
| cas | 27219-07-4 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 50g | 560.24 Pln | |
| Fluorochem | 100g | 997.58 Pln | |
| Fluorochem | 250g | 2278.38 Pln | |
| Fluorochem | 500g | 4027.77 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 27219-07-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: GFMRZAMDGJIWRB-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | GFMRZAMDGJIWRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)O |
Computed by PubChem (NCBI)