cas: 27219-07-4 — see every product listed under this CAS number, including other names
Boc-5-Aminopentanoic acid, 95%, 95% (CAS 27219-07-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145JN-250mg |
| cas | 27219-07-4 |
| size | 250mg |
| availability | 2500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 100g | 717.20 Pln | |
| Chemat | 500g | 3417.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 27219-07-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: GFMRZAMDGJIWRB-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | GFMRZAMDGJIWRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)O |
Computed by PubChem (NCBI)