CAS 27219-07-4 appears in our catalog under these names: Boc-NH-C4-acid, Boc–δ–aminovaleric acid, BOC-5-Aminopentanoic acid, 97%, N-(tert-Butoxycarbonyl)-5-aminovaleric Acid, >98.0%(GC)(T), Boc-5-Ava-OH 97%. Offered by: TargetMol, GLPBio, Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 500mg, 25g, 5g, 250mg, 1g, 10g, 100g, 500g.
5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 27219-07-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: GFMRZAMDGJIWRB-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | GFMRZAMDGJIWRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)O |
Computed by PubChem (NCBI)