cas: 240122-25-2 — see every product listed under this CAS number, including other names
5-Bromo-1,2-Difluoro-3-(Trifluoromethyl)Benzene, 97%, 97% (CAS 240122-25-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BDV9-100mg |
| cas | 240122-25-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 539.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1,2-difluoro-3-(trifluoromethyl)benzene (CAS 240122-25-2) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 5-bromo-1,2-difluoro-3-(trifluoromethyl)benzene. InChIKey: YPARTGIVEPLLGK-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 5-bromo-1,2-difluoro-3-(trifluoromethyl)benzene |
| InChIKey | YPARTGIVEPLLGK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)F)Br |
Computed by PubChem (NCBI)