5-Bromo-1,3-dimethyl-1H-indole, 97%
cas: 10075-49-7 — see every product listed under this CAS number, including other names
5-Bromo-1,3-dimethyl-1H-indole, 97% (CAS 10075-49-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A167400-250mg |
| cas | 10075-49-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 1738.75 Pln | |
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 851.60 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| BLDpharm | 100mg | 347.68 Pln | |
| BLDpharm | 250mg | 736.43 Pln | |
| BLDpharm | 1g | 1869.37 Pln | |
| Fluorochem | 100mg | 919.49 Pln | |
| Fluorochem | 250mg | 1580.71 Pln | |
| Fluorochem | 1g | 3934.05 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-1,3-dimethylindole (CAS 10075-49-7) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 5-bromo-1,3-dimethylindole. InChIKey: QVWBXPVEGYLTRQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 5-bromo-1,3-dimethylindole |
| InChIKey | QVWBXPVEGYLTRQ-UHFFFAOYSA-N |
| SMILES | CC1=CN(C2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)