CAS 557107-03-6 appears in our catalog under these names: 2-(2-Bromoethyl)-1h-indole, 95%, 2–(2–Bromoethyl)–1H–indole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg.
2-(2-bromoethyl)-1H-indole (CAS 557107-03-6) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 2-(2-bromoethyl)-1H-indole. InChIKey: XCCDTRUNWZWKQR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 2-(2-bromoethyl)-1H-indole |
| InChIKey | XCCDTRUNWZWKQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)CCBr |
Computed by PubChem (NCBI)