CAS 10075-49-7 appears in our catalog under these names: 5-Bromo-1,3-dimethyl-1h-indole, 95%, 5-Bromo-1,3-dimethyl-1H-indole, 97%, 97%, 5-Bromo-1,3-dimethyl-1H-indole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-1,3-dimethylindole (CAS 10075-49-7) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 5-bromo-1,3-dimethylindole. InChIKey: QVWBXPVEGYLTRQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 5-bromo-1,3-dimethylindole |
| InChIKey | QVWBXPVEGYLTRQ-UHFFFAOYSA-N |
| SMILES | CC1=CN(C2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)