CAS 137160-23-7 is the registry number for Naphthalen-1-amine hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Naphthalen-1-amine;hydrobromide (CAS 137160-23-7) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: naphthalen-1-amine;hydrobromide. InChIKey: LFYWPCVGWROEOV-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | naphthalen-1-amine;hydrobromide |
| InChIKey | LFYWPCVGWROEOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N.Br |
Computed by PubChem (NCBI)