CAS 22217-79-4 appears in our catalog under these names: 5-(4-Bromophenyl)-3,4-dihydro-2h-pyrrole, 95%, 5-(4-Bromophenyl)-3,4-dihydro-2H-pyrrole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
5-(4-bromophenyl)-3,4-dihydro-2H-pyrrole (CAS 22217-79-4) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 5-(4-bromophenyl)-3,4-dihydro-2H-pyrrole. InChIKey: JWFYKOZMQNALPB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3,4-dihydro-2H-pyrrole |
| InChIKey | JWFYKOZMQNALPB-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)