cas: 27611-39-8 — see every product listed under this CAS number, including other names
5-Bromo-1,3-indandione, 98%, 98% (CAS 27611-39-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BITN-100mg |
| cas | 27611-39-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 1970.00 Pln | |
| Chemat | 25g | 7058.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromoindene-1,3-dione (CAS 27611-39-8) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromoindene-1,3-dione. InChIKey: ADTNQTYUZPHLAS-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromoindene-1,3-dione |
| InChIKey | ADTNQTYUZPHLAS-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)