CAS 51483-92-2 appears in our catalog under these names: 6-Bromochromone, >98.0%(GC), 6-Bromochromone 98%, 6-Bromo-4H-Chromen-4-One, 98%, 98%, 6-Bromo-4H-chromen-4-one, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g, 10g.
6-bromochromen-4-one (CAS 51483-92-2) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 6-bromochromen-4-one. InChIKey: XVNBWGGBXOJIDR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 6-bromochromen-4-one |
| InChIKey | XVNBWGGBXOJIDR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C=CO2 |
Computed by PubChem (NCBI)